C23H30FN5O — CID 156887871
(Z)-2-[4-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-3-hydroxyphenyl]-N-methylpent-2-enimidoyl fluoride (PubChem CID 156887871) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is (Z)-2-[4-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-3-hydroxyphenyl]-N-methylpent-2-enimidoyl fluoride.
| Compound Name | (Z)-2-[4-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-3-hydroxyphenyl]-N-methylpent-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 156887871 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (Z)-2-[4-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-3-hydroxyphenyl]-N-methylpent-2-enimidoyl fluoride |
| SMILES | CC/C=C(C(\F)=N\C)/c1ccc(C2=NN=C(N3CCNCC3)CC(CC)=C2)c(O)c1 |
| InChI | InChI=1S/C23H30FN5O/c1-4-6-18(23(24)25-3)17-7-8-19(21(30)15-17)20-13-16(5-2)14-22(28-27-20)29-11-9-26-10-12-29/h6-8,13,15,26,30H,4-5,9-12,14H2,1-3H3/b18-6-,25-23- |
| InChIKey | WHOYKFKKKWQACS-FFJOGUJJSA-N |
| XLogP | 3.93 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|