C30H46N6O — CID 156887386
5-[(3E)-5,6-bis(methylimino)hepta-1,3-dien-3-yl]-2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)phenol;ethane (PubChem CID 156887386) has the molecular formula C30H46N6O and a molecular weight of 506.74 g/mol. Its IUPAC name is 5-[(3E)-5,6-bis(methylimino)hepta-1,3-dien-3-yl]-2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)phenol;ethane.
| Compound Name | 5-[(3E)-5,6-bis(methylimino)hepta-1,3-dien-3-yl]-2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)phenol;ethane |
|---|---|
| PubChem CID | 156887386 |
| Molecular Formula | C30H46N6O |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | 5-[(3E)-5,6-bis(methylimino)hepta-1,3-dien-3-yl]-2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)phenol;ethane |
| SMILES | C=C/C(=C\C(=N\C)\C(C)=N\C)c1ccc(C2=NN=C(N3CCNCC3)CC(CC)=C2)c(O)c1.CC.CC |
| InChI | InChI=1S/C26H34N6O.2C2H6/c1-6-19-14-24(30-31-26(15-19)32-12-10-29-11-13-32)22-9-8-21(17-25(22)33)20(7-2)16-23(28-5)18(3)27-4;2*1-2/h7-9,14,16-17,29,33H,2,6,10-13,15H2,1,3-5H3;2*1-2H3/b20-16+,27-18+,28-23-;; |
| InChIKey | JXPIQMOMPZNNHH-OUHSZEQZSA-N |
| XLogP | 5.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|