C25H35N5O — CID 156887994
2-[5-ethyl-3-(3-ethylpiperazin-1-yl)-4H-diazepin-7-yl]-5-[(Z)-1-methyliminopent-2-en-2-yl]phenol (PubChem CID 156887994) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[5-ethyl-3-(3-ethylpiperazin-1-yl)-4H-diazepin-7-yl]-5-[(Z)-1-methyliminopent-2-en-2-yl]phenol.
| Compound Name | 2-[5-ethyl-3-(3-ethylpiperazin-1-yl)-4H-diazepin-7-yl]-5-[(Z)-1-methyliminopent-2-en-2-yl]phenol |
|---|---|
| PubChem CID | 156887994 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-[5-ethyl-3-(3-ethylpiperazin-1-yl)-4H-diazepin-7-yl]-5-[(Z)-1-methyliminopent-2-en-2-yl]phenol |
| SMILES | CC/C=C(\C=N\C)c1ccc(C2=NN=C(N3CCNC(CC)C3)CC(CC)=C2)c(O)c1 |
| InChI | InChI=1S/C25H35N5O/c1-5-8-20(16-26-4)19-9-10-22(24(31)15-19)23-13-18(6-2)14-25(29-28-23)30-12-11-27-21(7-3)17-30/h8-10,13,15-16,21,27,31H,5-7,11-12,14,17H2,1-4H3/b20-8+,26-16+ |
| InChIKey | DSUUNEAMPNRQJO-LIUGNJRASA-N |
| XLogP | 4.41 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|