C23H30O15 — CID 15334883
methyl (2S,3R,4S)-3,4-diacetyloxy-2-[(2S,3R,4R,5S,6S)-2,4,5-triacetyloxy-6-methyloxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 15334883) has the molecular formula C23H30O15 and a molecular weight of 546.48 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3,4-diacetyloxy-2-[(2S,3R,4R,5S,6S)-2,4,5-triacetyloxy-6-methyloxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3,4-diacetyloxy-2-[(2S,3R,4R,5S,6S)-2,4,5-triacetyloxy-6-methyloxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 15334883 |
| Molecular Formula | C23H30O15 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | methyl (2S,3R,4S)-3,4-diacetyloxy-2-[(2S,3R,4R,5S,6S)-2,4,5-triacetyloxy-6-methyloxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](O[C@H]2[C@H](OC(C)=O)O[C@@H](C)[C@H](OC(C)=O)[C@H]2OC(C)=O)O1 |
| InChI | InChI=1S/C23H30O15/c1-9-17(33-11(3)25)19(35-13(5)27)20(23(31-9)36-14(6)28)38-22-18(34-12(4)26)15(32-10(2)24)8-16(37-22)21(29)30-7/h8-9,15,17-20,22-23H,1-7H3/t9-,15-,17-,18+,19+,20+,22+,23-/m0/s1 |
| InChIKey | HDOPPEJVKGTALN-BEVMXIHBSA-N |
| XLogP | -0.18 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|