C7H13NO2S — CID 153349612
2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol (PubChem CID 153349612) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol.
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol |
|---|---|
| PubChem CID | 153349612 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol |
| SMILES | OCC(NS)C1CCC=CO1 |
| InChI | InChI=1S/C7H13NO2S/c9-5-6(8-11)7-3-1-2-4-10-7/h2,4,6-9,11H,1,3,5H2 |
| InChIKey | LYWMEKYQZXZQFQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|