C11H23NO2S — CID 153349611
2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol;2-methylpropane (PubChem CID 153349611) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol;2-methylpropane.
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol;2-methylpropane |
|---|---|
| PubChem CID | 153349611 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-yl)-2-(sulfanylamino)ethanol;2-methylpropane |
| SMILES | CC(C)C.OCC(NS)C1CCC=CO1 |
| InChI | InChI=1S/C7H13NO2S.C4H10/c9-5-6(8-11)7-3-1-2-4-10-7;1-4(2)3/h2,4,6-9,11H,1,3,5H2;4H,1-3H3 |
| InChIKey | SETQDYAMTFTFAZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|