C27H30N4OS — CID 153353696
1-[2-[4-(2-ethyl-5,7-dimethylbenzimidazol-1-yl)phenyl]ethyl]-3-(4-methylphenyl)sulfanylurea (PubChem CID 153353696) has the molecular formula C27H30N4OS and a molecular weight of 458.63 g/mol. Its IUPAC name is 1-[2-[4-(2-ethyl-5,7-dimethylbenzimidazol-1-yl)phenyl]ethyl]-3-(4-methylphenyl)sulfanylurea.
| Compound Name | 1-[2-[4-(2-ethyl-5,7-dimethylbenzimidazol-1-yl)phenyl]ethyl]-3-(4-methylphenyl)sulfanylurea |
|---|---|
| PubChem CID | 153353696 |
| Molecular Formula | C27H30N4OS |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-[2-[4-(2-ethyl-5,7-dimethylbenzimidazol-1-yl)phenyl]ethyl]-3-(4-methylphenyl)sulfanylurea |
| SMILES | CCc1nc2cc(C)cc(C)c2n1-c1ccc(CCNC(=O)NSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H30N4OS/c1-5-25-29-24-17-19(3)16-20(4)26(24)31(25)22-10-8-21(9-11-22)14-15-28-27(32)30-33-23-12-6-18(2)7-13-23/h6-13,16-17H,5,14-15H2,1-4H3,(H2,28,30,32) |
| InChIKey | SAIMEVJJKYQRBA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|