C25H27ClN6O3S — CID 172814931
1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-[4-(5-chloro-2-ethyl-7-methylimidazo[4,5-b]pyridin-3-yl)phenyl]ethyl]urea (PubChem CID 172814931) has the molecular formula C25H27ClN6O3S and a molecular weight of 527.05 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-[4-(5-chloro-2-ethyl-7-methylimidazo[4,5-b]pyridin-3-yl)phenyl]ethyl]urea.
| Compound Name | 1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-[4-(5-chloro-2-ethyl-7-methylimidazo[4,5-b]pyridin-3-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 172814931 |
| Molecular Formula | C25H27ClN6O3S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-[4-(5-chloro-2-ethyl-7-methylimidazo[4,5-b]pyridin-3-yl)phenyl]ethyl]urea |
| SMILES | CCc1nc2c(C)cc(Cl)nc2n1-c1ccc(CCNC(=O)NS(=O)(=O)c2ccc(CN)cc2)cc1 |
| InChI | InChI=1S/C25H27ClN6O3S/c1-3-22-30-23-16(2)14-21(26)29-24(23)32(22)19-8-4-17(5-9-19)12-13-28-25(33)31-36(34,35)20-10-6-18(15-27)7-11-20/h4-11,14H,3,12-13,15,27H2,1-2H3,(H2,28,31,33) |
| InChIKey | SRJZCXQREALDPR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|