C26H31N5NaO3S — CID 159827963
CID 159827963 (PubChem CID 159827963) has the molecular formula C26H31N5NaO3S and a molecular weight of 516.62 g/mol.
| Compound Name | CID 159827963 |
|---|---|
| PubChem CID | 159827963 |
| Molecular Formula | C26H31N5NaO3S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | — |
| SMILES | CCC1Nc2c(C)cccc2N1c1ccc(CCNC(=O)NS(=O)(=O)c2ccc(CN)cc2)cc1.[Na] |
| InChI | InChI=1S/C26H31N5O3S.Na/c1-3-24-29-25-18(2)5-4-6-23(25)31(24)21-11-7-19(8-12-21)15-16-28-26(32)30-35(33,34)22-13-9-20(17-27)10-14-22;/h4-14,24,29H,3,15-17,27H2,1-2H3,(H2,28,30,32); |
| InChIKey | FSLWJSTXQNHYLV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |