C18H22ClN3O3S — CID 174454675
1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-(2-chloro-6-ethylphenyl)ethyl]urea (PubChem CID 174454675) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-(2-chloro-6-ethylphenyl)ethyl]urea.
| Compound Name | 1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-(2-chloro-6-ethylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 174454675 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]sulfonyl-3-[2-(2-chloro-6-ethylphenyl)ethyl]urea |
| SMILES | CCc1cccc(Cl)c1CCNC(=O)NS(=O)(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-2-14-4-3-5-17(19)16(14)10-11-21-18(23)22-26(24,25)15-8-6-13(12-20)7-9-15/h3-9H,2,10-12,20H2,1H3,(H2,21,22,23) |
| InChIKey | NZZDCYGAIUZXER-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |