C19H21F2NO3S — CID 153354124
1-[(E)-2-[4-(difluoromethoxy)-3-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-dimethylpyridin-4-one (PubChem CID 153354124) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[(E)-2-[4-(difluoromethoxy)-3-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-dimethylpyridin-4-one.
| Compound Name | 1-[(E)-2-[4-(difluoromethoxy)-3-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 153354124 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-[(E)-2-[4-(difluoromethoxy)-3-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-dimethylpyridin-4-one |
| SMILES | CSCCOc1cc(/C=C/n2c(C)cc(=O)cc2C)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2NO3S/c1-13-10-16(23)11-14(2)22(13)7-6-15-4-5-17(25-19(20)21)18(12-15)24-8-9-26-3/h4-7,10-12,19H,8-9H2,1-3H3/b7-6+ |
| InChIKey | JDPWCRFUSURYTN-VOTSOKGWSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|