C32H40N2 — CID 153355251
N-methyl-7-[4-[(E)-2-[4-[(E)-2-[4-(methylaminomethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]heptan-1-amine (PubChem CID 153355251) has the molecular formula C32H40N2 and a molecular weight of 452.69 g/mol. Its IUPAC name is N-methyl-7-[4-[(E)-2-[4-[(E)-2-[4-(methylaminomethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]heptan-1-amine.
| Compound Name | N-methyl-7-[4-[(E)-2-[4-[(E)-2-[4-(methylaminomethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]heptan-1-amine |
|---|---|
| PubChem CID | 153355251 |
| Molecular Formula | C32H40N2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | N-methyl-7-[4-[(E)-2-[4-[(E)-2-[4-(methylaminomethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]heptan-1-amine |
| SMILES | CNCCCCCCCc1ccc(/C=C/c2ccc(/C=C/c3ccc(CNC)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H40N2/c1-33-25-7-5-3-4-6-8-27-9-11-28(12-10-27)13-14-29-15-17-30(18-16-29)19-20-31-21-23-32(24-22-31)26-34-2/h9-24,33-34H,3-8,25-26H2,1-2H3/b14-13+,20-19+ |
| InChIKey | KUYMSQIKKYWFAW-CINXTQGDSA-N |
| XLogP | 7.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|