C21H29ClN8O — CID 153355459
2-[[(Z)-3-amino-2-[(6-chloro-3-pyridinyl)methyliminomethyl]prop-2-enyl]amino]-4,8-dimethyl-5,7-dihydropteridin-6-one;propane (PubChem CID 153355459) has the molecular formula C21H29ClN8O and a molecular weight of 444.97 g/mol. Its IUPAC name is 2-[[(Z)-3-amino-2-[(6-chloro-3-pyridinyl)methyliminomethyl]prop-2-enyl]amino]-4,8-dimethyl-5,7-dihydropteridin-6-one;propane.
| Compound Name | 2-[[(Z)-3-amino-2-[(6-chloro-3-pyridinyl)methyliminomethyl]prop-2-enyl]amino]-4,8-dimethyl-5,7-dihydropteridin-6-one;propane |
|---|---|
| PubChem CID | 153355459 |
| Molecular Formula | C21H29ClN8O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[[(Z)-3-amino-2-[(6-chloro-3-pyridinyl)methyliminomethyl]prop-2-enyl]amino]-4,8-dimethyl-5,7-dihydropteridin-6-one;propane |
| SMILES | CCC.Cc1nc(NCC(=C/N)/C=N/Cc2ccc(Cl)nc2)nc2c1NC(=O)CN2C |
| InChI | InChI=1S/C18H21ClN8O.C3H8/c1-11-16-17(27(2)10-15(28)25-16)26-18(24-11)23-9-13(5-20)7-21-6-12-3-4-14(19)22-8-12;1-3-2/h3-5,7-8H,6,9-10,20H2,1-2H3,(H,25,28)(H,23,24,26);3H2,1-2H3/b13-5+,21-7+; |
| InChIKey | HAUHDIHFYLCABW-LDLKBIDYSA-N |
| XLogP | 3.16 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|