C13H18BN5 — CID 153358442
2-(3-methylpiperazin-1-yl)-7,8-dihydro-5H-borinino[4,3-d]pyrimidine-6-carbonitrile (PubChem CID 153358442) has the molecular formula C13H18BN5 and a molecular weight of 255.13 g/mol. Its IUPAC name is 2-(3-methylpiperazin-1-yl)-7,8-dihydro-5H-borinino[4,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 2-(3-methylpiperazin-1-yl)-7,8-dihydro-5H-borinino[4,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 153358442 |
| Molecular Formula | C13H18BN5 |
| Molecular Weight | 255.13 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-(3-methylpiperazin-1-yl)-7,8-dihydro-5H-borinino[4,3-d]pyrimidine-6-carbonitrile |
| SMILES | CC1CN(c2ncc3c(n2)CCB(C#N)C3)CCN1 |
| InChI | InChI=1S/C13H18BN5/c1-10-8-19(5-4-16-10)13-17-7-11-6-14(9-15)3-2-12(11)18-13/h7,10,16H,2-6,8H2,1H3 |
| InChIKey | YABQNDLQRSFNPE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.13 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|