C19H28ClN4O5P — CID 153359101
[2-[[5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonous acid (PubChem CID 153359101) has the molecular formula C19H28ClN4O5P and a molecular weight of 458.88 g/mol. Its IUPAC name is [2-[[5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonous acid.
| Compound Name | [2-[[5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonous acid |
|---|---|
| PubChem CID | 153359101 |
| Molecular Formula | C19H28ClN4O5P |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-[[5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methoxy]-1-hydroxypropan-2-yl]phosphonous acid |
| SMILES | CC(CO)(OCC1CCC(n2ncc3c(NC4CCCC4)cc(Cl)nc32)O1)P(O)O |
| InChI | InChI=1S/C19H28ClN4O5P/c1-19(11-25,30(26)27)28-10-13-6-7-17(29-13)24-18-14(9-21-24)15(8-16(20)23-18)22-12-4-2-3-5-12/h8-9,12-13,17,25-27H,2-7,10-11H2,1H3,(H,22,23) |
| InChIKey | HDZHQQYSBZGMHC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|