C24H29FN6O2 — CID 153363923
tert-butyl N-[3-fluoro-2-[4-[[(2R)-2-methyl-2H-pyrrol-5-yl]amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate (PubChem CID 153363923) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is tert-butyl N-[3-fluoro-2-[4-[[(2R)-2-methyl-2H-pyrrol-5-yl]amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate.
| Compound Name | tert-butyl N-[3-fluoro-2-[4-[[(2R)-2-methyl-2H-pyrrol-5-yl]amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate |
|---|---|
| PubChem CID | 153363923 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | tert-butyl N-[3-fluoro-2-[4-[[(2R)-2-methyl-2H-pyrrol-5-yl]amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]carbamate |
| SMILES | C[C@@H]1C=CC(Nc2ncnc(-c3cc4c(cc3F)C(NC(=O)OC(C)(C)C)CCCC4)n2)=N1 |
| InChI | InChI=1S/C24H29FN6O2/c1-14-9-10-20(28-14)30-22-27-13-26-21(31-22)17-11-15-7-5-6-8-19(16(15)12-18(17)25)29-23(32)33-24(2,3)4/h9-14,19H,5-8H2,1-4H3,(H,29,32)(H,26,27,28,30,31)/t14-,19?/m1/s1 |
| InChIKey | OVLLLCNRZYNKDW-MJTSIZKDSA-N |
| XLogP | 4.74 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |