About potassium;3-(oxidooxymethyl)octane;propane
potassium;3-(oxidooxymethyl)octane;propane (PubChem CID 153365242) has the molecular formula C12H27KO2
and a molecular weight of 242.44 g/mol. Its IUPAC name is potassium;3-(oxidooxymethyl)octane;propane.
Molecular Properties
| Compound Name | potassium;3-(oxidooxymethyl)octane;propane |
| PubChem CID | 153365242 |
| Molecular Formula | C12H27KO2 |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | potassium;3-(oxidooxymethyl)octane;propane |
| SMILES | CCC.CCCCCC(CC)CO[O-].[K+] |
| InChI | InChI=1S/C9H20O2.C3H8.K/c1-3-5-6-7-9(4-2)8-11-10;1-3-2;/h9-10H,3-8H2,1-2H3;3H2,1-2H3;/q;;+1/p-1 |
| InChIKey | ILLAOXIPMHWBJZ-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze potassium;3-(oxidooxymethyl)octane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-(oxidooxymethyl)octane;propane?
The IUPAC name of potassium;3-(oxidooxymethyl)octane;propane (CID 153365242) is potassium;3-(oxidooxymethyl)octane;propane.
What is the SMILES notation for potassium;3-(oxidooxymethyl)octane;propane?
The canonical SMILES for potassium;3-(oxidooxymethyl)octane;propane is CCC.CCCCCC(CC)CO[O-].[K+].
What is the InChIKey of potassium;3-(oxidooxymethyl)octane;propane?
The InChIKey is ILLAOXIPMHWBJZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20O2.C3H8.K/c1-3-5-6-7-9(4-2)8-11-10;1-3-2;/h9-10H,3-8H2,1-2H3;3H2,1-2H3;/q;;+1/p-1.
What are the key properties of potassium;3-(oxidooxymethyl)octane;propane?
potassium;3-(oxidooxymethyl)octane;propane has a molecular weight of 242.44 g/mol, XLogP of 0.31, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-(oxidooxymethyl)octane;propane is sourced from PubChem (CID 153365242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).