C21H18ClFN4O — CID 153366451
2-[(4-chlorophenyl)methylamino]-8-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 153366451) has the molecular formula C21H18ClFN4O and a molecular weight of 396.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylamino]-8-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[(4-chlorophenyl)methylamino]-8-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 153366451 |
| Molecular Formula | C21H18ClFN4O |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methylamino]-8-[(2Z)-2-ethenyl-3-fluoropenta-2,4-dienyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=C/C(F)=C(\C=C)Cn1c(=O)ccc2cnc(NCc3ccc(Cl)cc3)nc21 |
| InChI | InChI=1S/C21H18ClFN4O/c1-3-15(18(23)4-2)13-27-19(28)10-7-16-12-25-21(26-20(16)27)24-11-14-5-8-17(22)9-6-14/h3-10,12H,1-2,11,13H2,(H,24,25,26)/b18-15- |
| InChIKey | XEJICGGCSLWWQU-SDXDJHTJSA-N |
| XLogP | 4.65 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|