C10H12N4O — CID 18374883
2-(ethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 18374883) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(ethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(ethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18374883 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-(ethylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCNc1ncc2ccc(=O)n(C)c2n1 |
| InChI | InChI=1S/C10H12N4O/c1-3-11-10-12-6-7-4-5-8(15)14(2)9(7)13-10/h4-6H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | DCIHPOIFFJRFKS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |