C33H40FN3O5S — CID 153366736
ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[(1R)-1-[(4S)-8-fluoro-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate (PubChem CID 153366736) has the molecular formula C33H40FN3O5S and a molecular weight of 609.76 g/mol. Its IUPAC name is ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[(1R)-1-[(4S)-8-fluoro-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate.
| Compound Name | ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[(1R)-1-[(4S)-8-fluoro-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate |
|---|---|
| PubChem CID | 153366736 |
| Molecular Formula | C33H40FN3O5S |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | ethyl 3-[3-amino-5-methoxy-4-(methylamino)phenyl]-3-[(1R)-1-[(4S)-8-fluoro-4-methyl-1,1-dioxo-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoate |
| SMILES | CCOC(=O)CC(c1cc(N)c(NC)c(OC)c1)c1ccc(C)c2c1CC[C@H]2N1C[C@@H](C)Cc2ccc(F)cc2S1(=O)=O |
| InChI | InChI=1S/C33H40FN3O5S/c1-6-42-31(38)17-26(22-14-27(35)33(36-4)29(15-22)41-5)24-10-7-20(3)32-25(24)11-12-28(32)37-18-19(2)13-21-8-9-23(34)16-30(21)43(37,39)40/h7-10,14-16,19,26,28,36H,6,11-13,17-18,35H2,1-5H3/t19-,26?,28+/m0/s1 |
| InChIKey | FIIAAPCJYHYZAK-FVTDGNEISA-N |
| XLogP | 5.72 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|