C17H16F3N5OS — CID 153367028
[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(3R,4S)-3-fluoro-1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]methanone (PubChem CID 153367028) has the molecular formula C17H16F3N5OS and a molecular weight of 395.41 g/mol. Its IUPAC name is [(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(3R,4S)-3-fluoro-1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]methanone.
| Compound Name | [(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(3R,4S)-3-fluoro-1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 153367028 |
| Molecular Formula | C17H16F3N5OS |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[(3R,4S)-3-fluoro-1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]methanone |
| SMILES | O=C([C@@H]1CCN(c2nncs2)C[C@@H]1F)N1N=CC[C@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H16F3N5OS/c18-11-5-10(6-12(19)7-11)15-1-3-22-25(15)16(26)13-2-4-24(8-14(13)20)17-23-21-9-27-17/h3,5-7,9,13-15H,1-2,4,8H2/t13-,14+,15+/m1/s1 |
| InChIKey | DSGPYRNFEZAJTK-ILXRZTDVSA-N |
| XLogP | 2.94 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |