C22H22F4N6O2 — CID 151476644
6-[(3R,4S)-3-fluoro-4-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-N,N-dimethylpyrimidine-4-carboxamide (PubChem CID 151476644) has the molecular formula C22H22F4N6O2 and a molecular weight of 478.45 g/mol. Its IUPAC name is 6-[(3R,4S)-3-fluoro-4-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-N,N-dimethylpyrimidine-4-carboxamide.
| Compound Name | 6-[(3R,4S)-3-fluoro-4-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-N,N-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 151476644 |
| Molecular Formula | C22H22F4N6O2 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-[(3R,4S)-3-fluoro-4-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-N,N-dimethylpyrimidine-4-carboxamide |
| SMILES | CN(C)C(=O)c1cc(N2CC[C@@H](C(=O)N3N=CC[C@H]3c3cc(F)cc(F)c3F)[C@@H](F)C2)ncn1 |
| InChI | InChI=1S/C22H22F4N6O2/c1-30(2)22(34)17-9-19(28-11-27-17)31-6-4-13(16(25)10-31)21(33)32-18(3-5-29-32)14-7-12(23)8-15(24)20(14)26/h5,7-9,11,13,16,18H,3-4,6,10H2,1-2H3/t13-,16+,18+/m1/s1 |
| InChIKey | PLOWETQBUBYKOA-SKDZVZGDSA-N |
| XLogP | 2.72 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|