C17H15F4N5O2 — CID 153366851
[(3R,4S)-3-fluoro-1-(1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 153366851) has the molecular formula C17H15F4N5O2 and a molecular weight of 397.33 g/mol. Its IUPAC name is [(3R,4S)-3-fluoro-1-(1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | [(3R,4S)-3-fluoro-1-(1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 153366851 |
| Molecular Formula | C17H15F4N5O2 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [(3R,4S)-3-fluoro-1-(1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[(3S)-3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | O=C([C@@H]1CCN(c2nnco2)C[C@@H]1F)N1N=CC[C@H]1c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C17H15F4N5O2/c18-9-5-11(15(21)12(19)6-9)14-1-3-23-26(14)16(27)10-2-4-25(7-13(10)20)17-24-22-8-28-17/h3,5-6,8,10,13-14H,1-2,4,7H2/t10-,13+,14+/m1/s1 |
| InChIKey | CWIAWOLVSBGMBR-SWHYSGLUSA-N |
| XLogP | 2.61 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|