C7H15FN2 — CID 153367845
N-(2-fluoroethyl)-N'-prop-1-en-2-ylethane-1,2-diamine (PubChem CID 153367845) has the molecular formula C7H15FN2 and a molecular weight of 146.21 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N'-prop-1-en-2-ylethane-1,2-diamine.
| Compound Name | N-(2-fluoroethyl)-N'-prop-1-en-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 153367845 |
| Molecular Formula | C7H15FN2 |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | N-(2-fluoroethyl)-N'-prop-1-en-2-ylethane-1,2-diamine |
| SMILES | C=C(C)NCCNCCF |
| InChI | InChI=1S/C7H15FN2/c1-7(2)10-6-5-9-4-3-8/h9-10H,1,3-6H2,2H3 |
| InChIKey | FDNFEPNRFAUYNT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|