C18H17N2O4+ — CID 153370246
5-(3,4-dimethoxyphenyl)-N-pyridin-1-ium-3-ylfuran-2-carboxamide (PubChem CID 153370246) has the molecular formula C18H17N2O4+ and a molecular weight of 325.34 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-pyridin-1-ium-3-ylfuran-2-carboxamide.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-pyridin-1-ium-3-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 153370246 |
| Molecular Formula | C18H17N2O4+ |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-pyridin-1-ium-3-ylfuran-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)Nc3ccc[nH+]c3)o2)cc1OC |
| InChI | InChI=1S/C18H16N2O4/c1-22-15-6-5-12(10-17(15)23-2)14-7-8-16(24-14)18(21)20-13-4-3-9-19-11-13/h3-11H,1-2H3,(H,20,21)/p+1 |
| InChIKey | KXSRFYKJEOUWQW-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |