C9H10FN3 — CID 153370422
6-fluoro-N-methyl-3,8a-dihydroquinazolin-4-amine (PubChem CID 153370422) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is 6-fluoro-N-methyl-3,8a-dihydroquinazolin-4-amine.
| Compound Name | 6-fluoro-N-methyl-3,8a-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 153370422 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 6-fluoro-N-methyl-3,8a-dihydroquinazolin-4-amine |
| SMILES | CNC1=C2C=C(F)C=CC2N=CN1 |
| InChI | InChI=1S/C9H10FN3/c1-11-9-7-4-6(10)2-3-8(7)12-5-13-9/h2-5,8,11H,1H3,(H,12,13) |
| InChIKey | BJUYNZPMXJIXKC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |