C10H15N2+ — CID 142336221
3,8a-dihydroquinazolin-3-ium;ethane (PubChem CID 142336221) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is 3,8a-dihydroquinazolin-3-ium;ethane.
| Compound Name | 3,8a-dihydroquinazolin-3-ium;ethane |
|---|---|
| PubChem CID | 142336221 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 3,8a-dihydroquinazolin-3-ium;ethane |
| SMILES | C1=CC2=C[NH2+]C=NC2C=C1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-4-8-7(3-1)5-9-6-10-8;1-2/h1-6,8H,(H,9,10);1-2H3/p+1 |
| InChIKey | PFMCJAZAVKIRMS-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 28.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |