C18H34N2O4 — CID 153371809
(2S,5S)-2-amino-5-(dodecanoylamino)-4-oxohexanoic acid (PubChem CID 153371809) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2S,5S)-2-amino-5-(dodecanoylamino)-4-oxohexanoic acid.
| Compound Name | (2S,5S)-2-amino-5-(dodecanoylamino)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 153371809 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | (2S,5S)-2-amino-5-(dodecanoylamino)-4-oxohexanoic acid |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](C)C(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C18H34N2O4/c1-3-4-5-6-7-8-9-10-11-12-17(22)20-14(2)16(21)13-15(19)18(23)24/h14-15H,3-13,19H2,1-2H3,(H,20,22)(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | MHDKOWOZHMCQAN-GJZGRUSLSA-N |
| XLogP | 2.78 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|