C13H28NO2+ — CID 153373365
tert-butyl-(2-carboxyethyl)-(2,2-dimethylpropyl)-methylazanium (PubChem CID 153373365) has the molecular formula C13H28NO2+ and a molecular weight of 230.37 g/mol. Its IUPAC name is tert-butyl-(2-carboxyethyl)-(2,2-dimethylpropyl)-methylazanium.
| Compound Name | tert-butyl-(2-carboxyethyl)-(2,2-dimethylpropyl)-methylazanium |
|---|---|
| PubChem CID | 153373365 |
| Molecular Formula | C13H28NO2+ |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | tert-butyl-(2-carboxyethyl)-(2,2-dimethylpropyl)-methylazanium |
| SMILES | CC(C)(C)C[N+](C)(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-12(2,3)10-14(7,13(4,5)6)9-8-11(15)16/h8-10H2,1-7H3/p+1 |
| InChIKey | YSKBMYAWBVASMS-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|