C9H7F3N4OS — CID 15337427
6-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 15337427) has the molecular formula C9H7F3N4OS and a molecular weight of 276.24 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 15337427 |
| Molecular Formula | C9H7F3N4OS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 6-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | O=c1c2cnn(CC(F)(F)F)c2nc2n1CCS2 |
| InChI | InChI=1S/C9H7F3N4OS/c10-9(11,12)4-16-6-5(3-13-16)7(17)15-1-2-18-8(15)14-6/h3H,1-2,4H2 |
| InChIKey | WKDLHNBGRZJLAY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |