C8H6N4OS — CID 609734
6-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 609734) has the molecular formula C8H6N4OS and a molecular weight of 206.23 g/mol. Its IUPAC name is 6-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 6-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 609734 |
| Molecular Formula | C8H6N4OS |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 6-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | Cn1ncc2c(=O)n3ccsc3nc21 |
| InChI | InChI=1S/C8H6N4OS/c1-11-6-5(4-9-11)7(13)12-2-3-14-8(12)10-6/h2-4H,1H3 |
| InChIKey | BJRGPHUGHNOFHY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |