C7H4N4OS — CID 3073764
10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 3073764) has the molecular formula C7H4N4OS and a molecular weight of 192.20 g/mol. Its IUPAC name is 10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 3073764 |
| Molecular Formula | C7H4N4OS |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | O=c1c2cn[nH]c2nc2sccn12 |
| InChI | InChI=1S/C7H4N4OS/c12-6-4-3-8-10-5(4)9-7-11(6)1-2-13-7/h1-3H,(H,8,10) |
| InChIKey | SUIKOQQKAJOJIZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |