C9H8F3N5OS — CID 22401685
4-amino-5-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one (PubChem CID 22401685) has the molecular formula C9H8F3N5OS and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-amino-5-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one.
| Compound Name | 4-amino-5-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one |
|---|---|
| PubChem CID | 22401685 |
| Molecular Formula | C9H8F3N5OS |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-amino-5-(2,2,2-trifluoroethyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one |
| SMILES | Nc1c2c(=O)n3c(nc2nn1CC(F)(F)F)SCC3 |
| InChI | InChI=1S/C9H8F3N5OS/c10-9(11,12)3-17-5(13)4-6(15-17)14-8-16(7(4)18)1-2-19-8/h1-3,13H2 |
| InChIKey | TVQFHYBMZDPIJI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |