C9H11N5OS — CID 22401683
6-methyl-4-(methylamino)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 22401683) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 6-methyl-4-(methylamino)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-methyl-4-(methylamino)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 22401683 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-methyl-4-(methylamino)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | CNc1nn(C)c2nc3n(c(=O)c12)CCS3 |
| InChI | InChI=1S/C9H11N5OS/c1-10-6-5-7(13(2)12-6)11-9-14(8(5)15)3-4-16-9/h3-4H2,1-2H3,(H,10,12) |
| InChIKey | BVWUVCKXEFYPHY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |