C25H36N2 — CID 153375174
1-butyl-3-methyl-5-prop-2-enylbenzene;2-(methylideneamino)-N-[(4-methylphenyl)methyl]ethanamine (PubChem CID 153375174) has the molecular formula C25H36N2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 1-butyl-3-methyl-5-prop-2-enylbenzene;2-(methylideneamino)-N-[(4-methylphenyl)methyl]ethanamine.
| Compound Name | 1-butyl-3-methyl-5-prop-2-enylbenzene;2-(methylideneamino)-N-[(4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 153375174 |
| Molecular Formula | C25H36N2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | 1-butyl-3-methyl-5-prop-2-enylbenzene;2-(methylideneamino)-N-[(4-methylphenyl)methyl]ethanamine |
| SMILES | C=CCc1cc(C)cc(CCCC)c1.C=NCCNCc1ccc(C)cc1 |
| InChI | InChI=1S/C14H20.C11H16N2/c1-4-6-8-14-10-12(3)9-13(11-14)7-5-2;1-10-3-5-11(6-4-10)9-13-8-7-12-2/h5,9-11H,2,4,6-8H2,1,3H3;3-6,13H,2,7-9H2,1H3 |
| InChIKey | DFPRDMSFLHDDNE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|