C11H19NO — CID 153376208
(2Z,4Z)-6-methyl-2-propan-2-yloxyhepta-2,4,6-trien-3-amine (PubChem CID 153376208) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2Z,4Z)-6-methyl-2-propan-2-yloxyhepta-2,4,6-trien-3-amine.
| Compound Name | (2Z,4Z)-6-methyl-2-propan-2-yloxyhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 153376208 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2Z,4Z)-6-methyl-2-propan-2-yloxyhepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/C=C\C(N)=C(/C)OC(C)C |
| InChI | InChI=1S/C11H19NO/c1-8(2)6-7-11(12)10(5)13-9(3)4/h6-7,9H,1,12H2,2-5H3/b7-6-,11-10- |
| InChIKey | XUVMVDQELUWNIZ-QOXWLJPHSA-N |
| XLogP | 2.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|