C16H24BrN — CID 153376348
(4Z)-8-bromo-3,8-dimethyl-5-methylidene-4-prop-2-enylidenebicyclo[4.3.1]decan-1-amine (PubChem CID 153376348) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is (4Z)-8-bromo-3,8-dimethyl-5-methylidene-4-prop-2-enylidenebicyclo[4.3.1]decan-1-amine.
| Compound Name | (4Z)-8-bromo-3,8-dimethyl-5-methylidene-4-prop-2-enylidenebicyclo[4.3.1]decan-1-amine |
|---|---|
| PubChem CID | 153376348 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (4Z)-8-bromo-3,8-dimethyl-5-methylidene-4-prop-2-enylidenebicyclo[4.3.1]decan-1-amine |
| SMILES | C=C/C=C1\C(=C)C2CC(C)(Br)CC(N)(C2)CC1C |
| InChI | InChI=1S/C16H24BrN/c1-5-6-14-11(2)7-16(18)9-13(12(14)3)8-15(4,17)10-16/h5-6,11,13H,1,3,7-10,18H2,2,4H3/b14-6- |
| InChIKey | NVWNKEJCAKYBRR-NSIKDUERSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|