C29H30N6O2 — CID 153377500
(methylideneamino) 3-methoxy-N-[2-[4-(7-pyridin-3-ylquinolin-4-yl)piperazin-1-yl]ethyl]benzenecarboximidate (PubChem CID 153377500) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is (methylideneamino) 3-methoxy-N-[2-[4-(7-pyridin-3-ylquinolin-4-yl)piperazin-1-yl]ethyl]benzenecarboximidate.
| Compound Name | (methylideneamino) 3-methoxy-N-[2-[4-(7-pyridin-3-ylquinolin-4-yl)piperazin-1-yl]ethyl]benzenecarboximidate |
|---|---|
| PubChem CID | 153377500 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (methylideneamino) 3-methoxy-N-[2-[4-(7-pyridin-3-ylquinolin-4-yl)piperazin-1-yl]ethyl]benzenecarboximidate |
| SMILES | C=NO/C(=N\CCN1CCN(c2ccnc3cc(-c4cccnc4)ccc23)CC1)c1cccc(OC)c1 |
| InChI | InChI=1S/C29H30N6O2/c1-30-37-29(23-5-3-7-25(19-23)36-2)33-13-14-34-15-17-35(18-16-34)28-10-12-32-27-20-22(8-9-26(27)28)24-6-4-11-31-21-24/h3-12,19-21H,1,13-18H2,2H3/b33-29- |
| InChIKey | VUWLIEVYIBRXGH-IYOYZZHUSA-N |
| XLogP | 4.51 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|