C13H22N4O3 — CID 153379167
(3Z)-2-benzyl-3-hydrazinyl-3-hydrazinylidene-2-methoxypropanoic acid;ethane (PubChem CID 153379167) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3Z)-2-benzyl-3-hydrazinyl-3-hydrazinylidene-2-methoxypropanoic acid;ethane.
| Compound Name | (3Z)-2-benzyl-3-hydrazinyl-3-hydrazinylidene-2-methoxypropanoic acid;ethane |
|---|---|
| PubChem CID | 153379167 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3Z)-2-benzyl-3-hydrazinyl-3-hydrazinylidene-2-methoxypropanoic acid;ethane |
| SMILES | CC.COC(Cc1ccccc1)(C(=O)O)/C(=N/N)NN |
| InChI | InChI=1S/C11H16N4O3.C2H6/c1-18-11(10(16)17,9(14-12)15-13)7-8-5-3-2-4-6-8;1-2/h2-6H,7,12-13H2,1H3,(H,14,15)(H,16,17);1-2H3 |
| InChIKey | QILNLBDGCUUWSD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|