About (3-methoxyphenyl)methyl thiohypochlorite
(3-methoxyphenyl)methyl thiohypochlorite (PubChem CID 153381003) has the molecular formula C8H9ClOS
and a molecular weight of 188.68 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl thiohypochlorite.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl thiohypochlorite |
| PubChem CID | 153381003 |
| Molecular Formula | C8H9ClOS |
| Molecular Weight | 188.68 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | (3-methoxyphenyl)methyl thiohypochlorite |
| SMILES | COc1cccc(CSCl)c1 |
| InChI | InChI=1S/C8H9ClOS/c1-10-8-4-2-3-7(5-8)6-11-9/h2-5H,6H2,1H3 |
| InChIKey | LSLXLEAASWQELS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methoxyphenyl)methyl thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl thiohypochlorite?
The IUPAC name of (3-methoxyphenyl)methyl thiohypochlorite (CID 153381003) is (3-methoxyphenyl)methyl thiohypochlorite.
What is the SMILES notation for (3-methoxyphenyl)methyl thiohypochlorite?
The canonical SMILES for (3-methoxyphenyl)methyl thiohypochlorite is COc1cccc(CSCl)c1.
What is the InChIKey of (3-methoxyphenyl)methyl thiohypochlorite?
The InChIKey is LSLXLEAASWQELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClOS/c1-10-8-4-2-3-7(5-8)6-11-9/h2-5H,6H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl thiohypochlorite?
(3-methoxyphenyl)methyl thiohypochlorite has a molecular weight of 188.68 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl thiohypochlorite is sourced from PubChem (CID 153381003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).