C11H14N2OS — CID 87885199
1-[(3-methoxyphenyl)methylsulfanyl]-4,5-dihydroimidazole (PubChem CID 87885199) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methylsulfanyl]-4,5-dihydroimidazole.
| Compound Name | 1-[(3-methoxyphenyl)methylsulfanyl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 87885199 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-[(3-methoxyphenyl)methylsulfanyl]-4,5-dihydroimidazole |
| SMILES | COc1cccc(CSN2C=NCC2)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-11-4-2-3-10(7-11)8-15-13-6-5-12-9-13/h2-4,7,9H,5-6,8H2,1H3 |
| InChIKey | CAAJXCUOGKYCTI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|