C17H18N6S — CID 153383714
ethene;5-(5-imidazol-1-yl-2-pyridinyl)-N-methyl-6,7-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 153383714) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is ethene;5-(5-imidazol-1-yl-2-pyridinyl)-N-methyl-6,7-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | ethene;5-(5-imidazol-1-yl-2-pyridinyl)-N-methyl-6,7-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 153383714 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethene;5-(5-imidazol-1-yl-2-pyridinyl)-N-methyl-6,7-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | C=C.CNc1nc2c(s1)N=C(c1ccc(-n3ccnc3)cn1)CC2 |
| InChI | InChI=1S/C15H14N6S.C2H4/c1-16-15-20-13-5-4-12(19-14(13)22-15)11-3-2-10(8-18-11)21-7-6-17-9-21;1-2/h2-3,6-9H,4-5H2,1H3,(H,16,20);1-2H2 |
| InChIKey | GGOBRWGGGSUWOD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|