C16H27N3O3 — CID 153383937
(3R)-6-(5-propan-2-yl-1,2,4-oxadiazolidin-3-yl)spiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,4'-1,3-oxazolidine]-2'-one (PubChem CID 153383937) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3R)-6-(5-propan-2-yl-1,2,4-oxadiazolidin-3-yl)spiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,4'-1,3-oxazolidine]-2'-one.
| Compound Name | (3R)-6-(5-propan-2-yl-1,2,4-oxadiazolidin-3-yl)spiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,4'-1,3-oxazolidine]-2'-one |
|---|---|
| PubChem CID | 153383937 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (3R)-6-(5-propan-2-yl-1,2,4-oxadiazolidin-3-yl)spiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,4'-1,3-oxazolidine]-2'-one |
| SMILES | CC(C)C1NC(C2CCC3C(CC[C@]34COC(=O)N4)C2)NO1 |
| InChI | InChI=1S/C16H27N3O3/c1-9(2)14-17-13(19-22-14)11-3-4-12-10(7-11)5-6-16(12)8-21-15(20)18-16/h9-14,17,19H,3-8H2,1-2H3,(H,18,20)/t10?,11?,12?,13?,14?,16-/m0/s1 |
| InChIKey | DOJXRVHUASUCPI-QRXGVLDSSA-N |
| XLogP | 1.72 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |