C26H32N6O4 — CID 153384308
2-[3-[4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-5-(2-methoxyethoxy)quinazolin-2-yl]phenoxy]-N-tert-butylacetamide (PubChem CID 153384308) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-[3-[4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-5-(2-methoxyethoxy)quinazolin-2-yl]phenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[3-[4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-5-(2-methoxyethoxy)quinazolin-2-yl]phenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 153384308 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-[3-[4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-5-(2-methoxyethoxy)quinazolin-2-yl]phenoxy]-N-tert-butylacetamide |
| SMILES | [H]/N=C/C(=C\N)Nc1nc(-c2cccc(OCC(=O)NC(C)(C)C)c2)nc2cccc(OCCOC)c12 |
| InChI | InChI=1S/C26H32N6O4/c1-26(2,3)32-22(33)16-36-19-8-5-7-17(13-19)24-30-20-9-6-10-21(35-12-11-34-4)23(20)25(31-24)29-18(14-27)15-28/h5-10,13-15,27H,11-12,16,28H2,1-4H3,(H,32,33)(H,29,30,31)/b18-15+,27-14+ |
| InChIKey | MCXASWJXWDBJMH-ZOYZZGJYSA-N |
| XLogP | 3.48 |
| TPSA | 144.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|