C27H34N6O3 — CID 166026359
2-[3-[4-[[(E)-1-amino-3-ethyliminoprop-1-en-2-yl]amino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-tert-butylacetamide (PubChem CID 166026359) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[3-[4-[[(E)-1-amino-3-ethyliminoprop-1-en-2-yl]amino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[3-[4-[[(E)-1-amino-3-ethyliminoprop-1-en-2-yl]amino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 166026359 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 2-[3-[4-[[(E)-1-amino-3-ethyliminoprop-1-en-2-yl]amino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-tert-butylacetamide |
| SMILES | CC/N=C/C(=C\N)Nc1nc(-c2cccc(OCC(=O)NC(C)(C)C)c2)nc2ccc(OCC)cc12 |
| InChI | InChI=1S/C27H34N6O3/c1-6-29-16-19(15-28)30-26-22-14-21(35-7-2)11-12-23(22)31-25(32-26)18-9-8-10-20(13-18)36-17-24(34)33-27(3,4)5/h8-16H,6-7,17,28H2,1-5H3,(H,33,34)(H,30,31,32)/b19-15+,29-16+ |
| InChIKey | AUIZCTJBMNDDKT-XRGDGHGBSA-N |
| XLogP | 4.29 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|