C24H29N5O3 — CID 153385393
5-(2-amino-3-ethenylphenyl)-N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide;ethane (PubChem CID 153385393) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-(2-amino-3-ethenylphenyl)-N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide;ethane.
| Compound Name | 5-(2-amino-3-ethenylphenyl)-N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide;ethane |
|---|---|
| PubChem CID | 153385393 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 5-(2-amino-3-ethenylphenyl)-N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide;ethane |
| SMILES | C=Cc1cccc(-c2[nH]ncc2C(=O)NC(Cc2ccccc2)C(O)C(N)=O)c1N.CC |
| InChI | InChI=1S/C22H23N5O3.C2H6/c1-2-14-9-6-10-15(18(14)23)19-16(12-25-27-19)22(30)26-17(20(28)21(24)29)11-13-7-4-3-5-8-13;1-2/h2-10,12,17,20,28H,1,11,23H2,(H2,24,29)(H,25,27)(H,26,30);1-2H3 |
| InChIKey | DVPSBXYOVRDSNA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|