C22H23ClN6O2 — CID 153387536
N-[4-[3-[(E)-[4-(azetidin-1-yl)-5-chloropyrimidin-2-yl]iminomethyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 153387536) has the molecular formula C22H23ClN6O2 and a molecular weight of 438.92 g/mol. Its IUPAC name is N-[4-[3-[(E)-[4-(azetidin-1-yl)-5-chloropyrimidin-2-yl]iminomethyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-[(E)-[4-(azetidin-1-yl)-5-chloropyrimidin-2-yl]iminomethyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 153387536 |
| Molecular Formula | C22H23ClN6O2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[4-[3-[(E)-[4-(azetidin-1-yl)-5-chloropyrimidin-2-yl]iminomethyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCC(/C=N/c3ncc(Cl)c(N4CCC4)n3)C2)cc1 |
| InChI | InChI=1S/C22H23ClN6O2/c1-2-19(30)26-17-6-4-16(5-7-17)21(31)29-11-8-15(14-29)12-24-22-25-13-18(23)20(27-22)28-9-3-10-28/h2,4-7,12-13,15H,1,3,8-11,14H2,(H,26,30)/b24-12+ |
| InChIKey | XBTRCQUSAQTBHM-WYMPLXKRSA-N |
| XLogP | 3.33 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|