C20H18ClF3N4O2 — CID 169426722
N-[4-[(3S)-3-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 169426722) has the molecular formula C20H18ClF3N4O2 and a molecular weight of 438.84 g/mol. Its IUPAC name is N-[4-[(3S)-3-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(3S)-3-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 169426722 |
| Molecular Formula | C20H18ClF3N4O2 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N-[4-[(3S)-3-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CC[C@@H](Cc3ncc(Cl)c(C(F)(F)F)n3)C2)cc1 |
| InChI | InChI=1S/C20H18ClF3N4O2/c1-2-17(29)26-14-5-3-13(4-6-14)19(30)28-8-7-12(11-28)9-16-25-10-15(21)18(27-16)20(22,23)24/h2-6,10,12H,1,7-9,11H2,(H,26,29)/t12-/m0/s1 |
| InChIKey | KFMXDIWHFXJVKT-LBPRGKRZSA-N |
| XLogP | 3.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|