About CID 153387608
CID 153387608 (PubChem CID 153387608) has the molecular formula C19H19BFN5O3
and a molecular weight of 395.20 g/mol.
Molecular Properties
| Compound Name | CID 153387608 |
| PubChem CID | 153387608 |
| Molecular Formula | C19H19BFN5O3 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(/N=C/C2CCCCN(C(=O)c3ccc([N+](=O)[O-])c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C19H19BFN5O3/c20-15-11-23-19(24-12-15)22-10-13-3-1-2-7-25(8-6-13)18(27)14-4-5-17(26(28)29)16(21)9-14/h4-5,9-13H,1-3,6-8H2/b22-10+ |
| InChIKey | CROZYCUUFPDJKV-LSHDLFTRSA-N |
| XLogP | 2.35 |
| TPSA | 101.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 153387608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153387608?
The IUPAC name of CID 153387608 (CID 153387608) is not available.
What is the SMILES notation for CID 153387608?
The canonical SMILES for CID 153387608 is [B]c1cnc(/N=C/C2CCCCN(C(=O)c3ccc([N+](=O)[O-])c(F)c3)CC2)nc1.
What is the InChIKey of CID 153387608?
The InChIKey is CROZYCUUFPDJKV-LSHDLFTRSA-N. The full InChI is InChI=1S/C19H19BFN5O3/c20-15-11-23-19(24-12-15)22-10-13-3-1-2-7-25(8-6-13)18(27)14-4-5-17(26(28)29)16(21)9-14/h4-5,9-13H,1-3,6-8H2/b22-10+.
What are the key properties of CID 153387608?
CID 153387608 has a molecular weight of 395.20 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153387608 is sourced from PubChem (CID 153387608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).