C28H39N5O2 — CID 153388831
N-[[5-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl]methyl]formamide;ethane;propane (PubChem CID 153388831) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[[5-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl]methyl]formamide;ethane;propane.
| Compound Name | N-[[5-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl]methyl]formamide;ethane;propane |
|---|---|
| PubChem CID | 153388831 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | N-[[5-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl]methyl]formamide;ethane;propane |
| SMILES | CC.CCC.CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(O)c(CNC=O)c1 |
| InChI | InChI=1S/C23H25N5O2.C3H8.C2H6/c1-2-3-8-20-27-21-22(17-6-4-5-7-18(17)26-23(21)24)28(20)13-15-9-10-19(30)16(11-15)12-25-14-29;1-3-2;1-2/h4-7,9-11,14,30H,2-3,8,12-13H2,1H3,(H2,24,26)(H,25,29);3H2,1-2H3;1-2H3 |
| InChIKey | QZOGSPVPXCIEAZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|